C27H26N4O7 — CID 3640584
4-methoxy-N-[1-(5-methylfuran-2-yl)-3-oxo-3-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)prop-1-en-2-yl]-3-nitrobenzamide (PubChem CID 3640584) has the molecular formula C27H26N4O7 and a molecular weight of 518.53 g/mol. Its IUPAC name is 4-methoxy-N-[1-(5-methylfuran-2-yl)-3-oxo-3-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)prop-1-en-2-yl]-3-nitrobenzamide.
| Compound Name | 4-methoxy-N-[1-(5-methylfuran-2-yl)-3-oxo-3-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)prop-1-en-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 3640584 |
| Molecular Formula | C27H26N4O7 |
| Molecular Weight | 518.53 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | 4-methoxy-N-[1-(5-methylfuran-2-yl)-3-oxo-3-(6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-11-yl)prop-1-en-2-yl]-3-nitrobenzamide |
| SMILES | COc1ccc(C(=O)NC(=Cc2ccc(C)o2)C(=O)N2CC3CC(C2)c2cccc(=O)n2C3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H26N4O7/c1-16-6-8-20(38-16)12-21(28-26(33)18-7-9-24(37-2)23(11-18)31(35)36)27(34)29-13-17-10-19(15-29)22-4-3-5-25(32)30(22)14-17/h3-9,11-12,17,19H,10,13-15H2,1-2H3,(H,28,33) |
| InChIKey | QWMKKDDNRDXUGM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.53 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|