C36H45N3O7S — CID 99679958
ethyl (6R)-2-[[4-[(2R)-1-[(2Z)-2-[(3-ethoxy-4-pentoxyphenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]oxybenzoyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 99679958) has the molecular formula C36H45N3O7S and a molecular weight of 663.84 g/mol. Its IUPAC name is ethyl (6R)-2-[[4-[(2R)-1-[(2Z)-2-[(3-ethoxy-4-pentoxyphenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]oxybenzoyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl (6R)-2-[[4-[(2R)-1-[(2Z)-2-[(3-ethoxy-4-pentoxyphenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]oxybenzoyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 99679958 |
| Molecular Formula | C36H45N3O7S |
| Molecular Weight | 663.84 g/mol |
| Exact Mass | 663.30 |
| IUPAC Name | ethyl (6R)-2-[[4-[(2R)-1-[(2Z)-2-[(3-ethoxy-4-pentoxyphenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]oxybenzoyl]amino]-6-methyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCCCCOc1ccc(/C=N\NC(=O)[C@@H](C)Oc2ccc(C(=O)Nc3sc4c(c3C(=O)OCC)CC[C@@H](C)C4)cc2)cc1OCC |
| InChI | InChI=1S/C36H45N3O7S/c1-6-9-10-19-45-29-18-12-25(21-30(29)43-7-2)22-37-39-33(40)24(5)46-27-15-13-26(14-16-27)34(41)38-35-32(36(42)44-8-3)28-17-11-23(4)20-31(28)47-35/h12-16,18,21-24H,6-11,17,19-20H2,1-5H3,(H,38,41)(H,39,40)/b37-22-/t23-,24-/m1/s1 |
| InChIKey | KJHDOVLZVJDUKD-JURKPPSDSA-N |
| XLogP | 7.19 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.84 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|