C33H41N3O7S — CID 7905698
ethyl 2-[[4-[(2R)-1-[(2Z)-2-[(3-ethoxy-4-pentoxyphenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]oxybenzoyl]amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 7905698) has the molecular formula C33H41N3O7S and a molecular weight of 623.77 g/mol. Its IUPAC name is ethyl 2-[[4-[(2R)-1-[(2Z)-2-[(3-ethoxy-4-pentoxyphenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]oxybenzoyl]amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[4-[(2R)-1-[(2Z)-2-[(3-ethoxy-4-pentoxyphenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]oxybenzoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 7905698 |
| Molecular Formula | C33H41N3O7S |
| Molecular Weight | 623.77 g/mol |
| Exact Mass | 623.27 |
| IUPAC Name | ethyl 2-[[4-[(2R)-1-[(2Z)-2-[(3-ethoxy-4-pentoxyphenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]oxybenzoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCCCCOc1ccc(/C=N\NC(=O)[C@@H](C)Oc2ccc(C(=O)Nc3sc(C)c(C)c3C(=O)OCC)cc2)cc1OCC |
| InChI | InChI=1S/C33H41N3O7S/c1-7-10-11-18-42-27-17-12-24(19-28(27)40-8-2)20-34-36-30(37)22(5)43-26-15-13-25(14-16-26)31(38)35-32-29(33(39)41-9-3)21(4)23(6)44-32/h12-17,19-20,22H,7-11,18H2,1-6H3,(H,35,38)(H,36,37)/b34-20-/t22-/m1/s1 |
| InChIKey | WJPDBHMJIBTKOP-HIMAKTPXSA-N |
| XLogP | 6.68 |
| TPSA | 124.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.77 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|