C26H25ClFN3O5S — CID 3377084
ethyl 2-[[4-[1-[2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]oxybenzoyl]amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 3377084) has the molecular formula C26H25ClFN3O5S and a molecular weight of 546.02 g/mol. Its IUPAC name is ethyl 2-[[4-[1-[2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]oxybenzoyl]amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[4-[1-[2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]oxybenzoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3377084 |
| Molecular Formula | C26H25ClFN3O5S |
| Molecular Weight | 546.02 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | ethyl 2-[[4-[1-[2-[(2-chloro-6-fluorophenyl)methylidene]hydrazinyl]-1-oxopropan-2-yl]oxybenzoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)c2ccc(OC(C)C(=O)NN=Cc3c(F)cccc3Cl)cc2)sc(C)c1C |
| InChI | InChI=1S/C26H25ClFN3O5S/c1-5-35-26(34)22-14(2)16(4)37-25(22)30-24(33)17-9-11-18(12-10-17)36-15(3)23(32)31-29-13-19-20(27)7-6-8-21(19)28/h6-13,15H,5H2,1-4H3,(H,30,33)(H,31,32) |
| InChIKey | MLIXWQPRBLMLOR-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 106.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.02 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|