C20H20F2N4O2 — CID 996820
(5S,7R)-7-(difluoromethyl)-N-(furan-2-ylmethyl)-5-(4-methylphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 996820) has the molecular formula C20H20F2N4O2 and a molecular weight of 386.40 g/mol. Its IUPAC name is (5S,7R)-7-(difluoromethyl)-N-(furan-2-ylmethyl)-5-(4-methylphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5S,7R)-7-(difluoromethyl)-N-(furan-2-ylmethyl)-5-(4-methylphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 996820 |
| Molecular Formula | C20H20F2N4O2 |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | (5S,7R)-7-(difluoromethyl)-N-(furan-2-ylmethyl)-5-(4-methylphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | Cc1ccc([C@@H]2C[C@H](C(F)F)n3ncc(C(=O)NCc4ccco4)c3N2)cc1 |
| InChI | InChI=1S/C20H20F2N4O2/c1-12-4-6-13(7-5-12)16-9-17(18(21)22)26-19(25-16)15(11-24-26)20(27)23-10-14-3-2-8-28-14/h2-8,11,16-18,25H,9-10H2,1H3,(H,23,27)/t16-,17+/m0/s1 |
| InChIKey | AGQFUEOEINTQLC-DLBZAZTESA-N |
| XLogP | 4.08 |
| TPSA | 72.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |