C23H25F2N5O — CID 1151976
(5S,7S)-7-(difluoromethyl)-N-[4-(dimethylamino)phenyl]-5-(4-methylphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 1151976) has the molecular formula C23H25F2N5O and a molecular weight of 425.48 g/mol. Its IUPAC name is (5S,7S)-7-(difluoromethyl)-N-[4-(dimethylamino)phenyl]-5-(4-methylphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5S,7S)-7-(difluoromethyl)-N-[4-(dimethylamino)phenyl]-5-(4-methylphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 1151976 |
| Molecular Formula | C23H25F2N5O |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (5S,7S)-7-(difluoromethyl)-N-[4-(dimethylamino)phenyl]-5-(4-methylphenyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | Cc1ccc([C@@H]2C[C@@H](C(F)F)n3ncc(C(=O)Nc4ccc(N(C)C)cc4)c3N2)cc1 |
| InChI | InChI=1S/C23H25F2N5O/c1-14-4-6-15(7-5-14)19-12-20(21(24)25)30-22(28-19)18(13-26-30)23(31)27-16-8-10-17(11-9-16)29(2)3/h4-11,13,19-21,28H,12H2,1-3H3,(H,27,31)/t19-,20-/m0/s1 |
| InChIKey | VCAKXPVLWFNIEB-PMACEKPBSA-N |
| XLogP | 4.87 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|