C23H24F2N6O2S — CID 135568116
1-[[7-(difluoromethyl)-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]-3-(4-ethoxyphenyl)thiourea (PubChem CID 135568116) has the molecular formula C23H24F2N6O2S and a molecular weight of 486.55 g/mol. Its IUPAC name is 1-[[7-(difluoromethyl)-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]-3-(4-ethoxyphenyl)thiourea.
| Compound Name | 1-[[7-(difluoromethyl)-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]-3-(4-ethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 135568116 |
| Molecular Formula | C23H24F2N6O2S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 1-[[7-(difluoromethyl)-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]-3-(4-ethoxyphenyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)NNC(=O)c2cnn3c2NC(c2ccccc2)CC3C(F)F)cc1 |
| InChI | InChI=1S/C23H24F2N6O2S/c1-2-33-16-10-8-15(9-11-16)27-23(34)30-29-22(32)17-13-26-31-19(20(24)25)12-18(28-21(17)31)14-6-4-3-5-7-14/h3-11,13,18-20,28H,2,12H2,1H3,(H,29,32)(H2,27,30,34) |
| InChIKey | AJBUHOLIUPYEQN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 92.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|