C23H24F2N6OS — CID 136737169
1-[[(5R,7S)-7-(difluoromethyl)-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]-3-(2,4-dimethylphenyl)thiourea (PubChem CID 136737169) has the molecular formula C23H24F2N6OS and a molecular weight of 470.55 g/mol. Its IUPAC name is 1-[[(5R,7S)-7-(difluoromethyl)-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]-3-(2,4-dimethylphenyl)thiourea.
| Compound Name | 1-[[(5R,7S)-7-(difluoromethyl)-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]-3-(2,4-dimethylphenyl)thiourea |
|---|---|
| PubChem CID | 136737169 |
| Molecular Formula | C23H24F2N6OS |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 1-[[(5R,7S)-7-(difluoromethyl)-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]-3-(2,4-dimethylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)NNC(=O)c2cnn3c2N[C@@H](c2ccccc2)C[C@H]3C(F)F)c(C)c1 |
| InChI | InChI=1S/C23H24F2N6OS/c1-13-8-9-17(14(2)10-13)28-23(33)30-29-22(32)16-12-26-31-19(20(24)25)11-18(27-21(16)31)15-6-4-3-5-7-15/h3-10,12,18-20,27H,11H2,1-2H3,(H,29,32)(H2,28,30,33)/t18-,19+/m1/s1 |
| InChIKey | AHBFWOOPNFHTJD-MOPGFXCFSA-N |
| XLogP | 4.49 |
| TPSA | 83.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|