C22H22F2N6OS — CID 135568028
1-[[7-(difluoromethyl)-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]-3-(2-methylphenyl)thiourea (PubChem CID 135568028) has the molecular formula C22H22F2N6OS and a molecular weight of 456.52 g/mol. Its IUPAC name is 1-[[7-(difluoromethyl)-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]-3-(2-methylphenyl)thiourea.
| Compound Name | 1-[[7-(difluoromethyl)-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]-3-(2-methylphenyl)thiourea |
|---|---|
| PubChem CID | 135568028 |
| Molecular Formula | C22H22F2N6OS |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | 1-[[7-(difluoromethyl)-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]-3-(2-methylphenyl)thiourea |
| SMILES | Cc1ccccc1NC(=S)NNC(=O)c1cnn2c1NC(c1ccccc1)CC2C(F)F |
| InChI | InChI=1S/C22H22F2N6OS/c1-13-7-5-6-10-16(13)27-22(32)29-28-21(31)15-12-25-30-18(19(23)24)11-17(26-20(15)30)14-8-3-2-4-9-14/h2-10,12,17-19,26H,11H2,1H3,(H,28,31)(H2,27,29,32) |
| InChIKey | QDNJCGDPNGFFNN-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 83.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|