C23H24F2N6O3S — CID 136737199
1-[[(5S,7S)-7-(difluoromethyl)-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]-3-(2,4-dimethoxyphenyl)thiourea (PubChem CID 136737199) has the molecular formula C23H24F2N6O3S and a molecular weight of 502.55 g/mol. Its IUPAC name is 1-[[(5S,7S)-7-(difluoromethyl)-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]-3-(2,4-dimethoxyphenyl)thiourea.
| Compound Name | 1-[[(5S,7S)-7-(difluoromethyl)-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]-3-(2,4-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 136737199 |
| Molecular Formula | C23H24F2N6O3S |
| Molecular Weight | 502.55 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 1-[[(5S,7S)-7-(difluoromethyl)-5-phenyl-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carbonyl]amino]-3-(2,4-dimethoxyphenyl)thiourea |
| SMILES | COc1ccc(NC(=S)NNC(=O)c2cnn3c2N[C@H](c2ccccc2)C[C@H]3C(F)F)c(OC)c1 |
| InChI | InChI=1S/C23H24F2N6O3S/c1-33-14-8-9-16(19(10-14)34-2)28-23(35)30-29-22(32)15-12-26-31-18(20(24)25)11-17(27-21(15)31)13-6-4-3-5-7-13/h3-10,12,17-18,20,27H,11H2,1-2H3,(H,29,32)(H2,28,30,35)/t17-,18-/m0/s1 |
| InChIKey | HTFOFUYZYPMACL-ROUUACIJSA-N |
| XLogP | 3.89 |
| TPSA | 101.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.55 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|