C19H22F2N4O2 — CID 136670391
(5R,7R)-5-cyclopropyl-7-(difluoromethyl)-N-[(4-methoxyphenyl)methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 136670391) has the molecular formula C19H22F2N4O2 and a molecular weight of 376.41 g/mol. Its IUPAC name is (5R,7R)-5-cyclopropyl-7-(difluoromethyl)-N-[(4-methoxyphenyl)methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (5R,7R)-5-cyclopropyl-7-(difluoromethyl)-N-[(4-methoxyphenyl)methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 136670391 |
| Molecular Formula | C19H22F2N4O2 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | (5R,7R)-5-cyclopropyl-7-(difluoromethyl)-N-[(4-methoxyphenyl)methyl]-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2cnn3c2N[C@@H](C2CC2)C[C@@H]3C(F)F)cc1 |
| InChI | InChI=1S/C19H22F2N4O2/c1-27-13-6-2-11(3-7-13)9-22-19(26)14-10-23-25-16(17(20)21)8-15(12-4-5-12)24-18(14)25/h2-3,6-7,10,12,15-17,24H,4-5,8-9H2,1H3,(H,22,26)/t15-,16-/m1/s1 |
| InChIKey | YPILUYPVRNKMLI-HZPDHXFCSA-N |
| XLogP | 3.22 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |