C35H47N5O6S2 — CID 99684084
[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[[2-[[4-(2-methylpropyl)-5-(3-morpholin-4-ylsulfonylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 99684084) has the molecular formula C35H47N5O6S2 and a molecular weight of 697.92 g/mol. Its IUPAC name is [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[[2-[[4-(2-methylpropyl)-5-(3-morpholin-4-ylsulfonylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[[2-[[4-(2-methylpropyl)-5-(3-morpholin-4-ylsulfonylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 99684084 |
| Molecular Formula | C35H47N5O6S2 |
| Molecular Weight | 697.92 g/mol |
| Exact Mass | 697.30 |
| IUPAC Name | [(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl] 2-[[2-[[4-(2-methylpropyl)-5-(3-morpholin-4-ylsulfonylphenyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | CC(C)Cn1c(SCC(=O)Nc2ccccc2C(=O)O[C@@H]2C[C@H](C)CC[C@H]2C(C)C)nnc1-c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C35H47N5O6S2/c1-23(2)21-40-33(26-9-8-10-27(20-26)48(43,44)39-15-17-45-18-16-39)37-38-35(40)47-22-32(41)36-30-12-7-6-11-29(30)34(42)46-31-19-25(5)13-14-28(31)24(3)4/h6-12,20,23-25,28,31H,13-19,21-22H2,1-5H3,(H,36,41)/t25-,28+,31-/m1/s1 |
| InChIKey | DCHAHKXCUJJRKU-KSWBWTIQSA-N |
| XLogP | 5.97 |
| TPSA | 132.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.92 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |