C16H13Cl2N5O — CID 99695727
N-(3,6-dichloro-2-pyridinyl)-6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxamide (PubChem CID 99695727) has the molecular formula C16H13Cl2N5O and a molecular weight of 362.22 g/mol. Its IUPAC name is N-(3,6-dichloro-2-pyridinyl)-6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxamide.
| Compound Name | N-(3,6-dichloro-2-pyridinyl)-6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 99695727 |
| Molecular Formula | C16H13Cl2N5O |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | N-(3,6-dichloro-2-pyridinyl)-6-(3,5-dimethylpyrazol-1-yl)pyridine-3-carboxamide |
| SMILES | Cc1cc(C)n(-c2ccc(C(=O)Nc3nc(Cl)ccc3Cl)cn2)n1 |
| InChI | InChI=1S/C16H13Cl2N5O/c1-9-7-10(2)23(22-9)14-6-3-11(8-19-14)16(24)21-15-12(17)4-5-13(18)20-15/h3-8H,1-2H3,(H,20,21,24) |
| InChIKey | GFIGZQDASWSVSQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|