C18H15ClFN5O2 — CID 99696829
1-(4-chloro-2-fluorophenyl)-5-methyl-N-[3-(methylcarbamoyl)phenyl]triazole-4-carboxamide (PubChem CID 99696829) has the molecular formula C18H15ClFN5O2 and a molecular weight of 387.80 g/mol. Its IUPAC name is 1-(4-chloro-2-fluorophenyl)-5-methyl-N-[3-(methylcarbamoyl)phenyl]triazole-4-carboxamide.
| Compound Name | 1-(4-chloro-2-fluorophenyl)-5-methyl-N-[3-(methylcarbamoyl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 99696829 |
| Molecular Formula | C18H15ClFN5O2 |
| Molecular Weight | 387.80 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 1-(4-chloro-2-fluorophenyl)-5-methyl-N-[3-(methylcarbamoyl)phenyl]triazole-4-carboxamide |
| SMILES | CNC(=O)c1cccc(NC(=O)c2nnn(-c3ccc(Cl)cc3F)c2C)c1 |
| InChI | InChI=1S/C18H15ClFN5O2/c1-10-16(23-24-25(10)15-7-6-12(19)9-14(15)20)18(27)22-13-5-3-4-11(8-13)17(26)21-2/h3-9H,1-2H3,(H,21,26)(H,22,27) |
| InChIKey | SWOAOTRVURMPHO-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.80 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |