C16H19N3O2 — CID 99698360
[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]-(3-methyl-1-phenylpyrazol-4-yl)methanone (PubChem CID 99698360) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is [(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]-(3-methyl-1-phenylpyrazol-4-yl)methanone.
| Compound Name | [(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]-(3-methyl-1-phenylpyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 99698360 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | [(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]-(3-methyl-1-phenylpyrazol-4-yl)methanone |
| SMILES | Cc1nn(-c2ccccc2)cc1C(=O)N1CCC[C@@H]1CO |
| InChI | InChI=1S/C16H19N3O2/c1-12-15(16(21)18-9-5-8-14(18)11-20)10-19(17-12)13-6-3-2-4-7-13/h2-4,6-7,10,14,20H,5,8-9,11H2,1H3/t14-/m1/s1 |
| InChIKey | LVKMARPWZFKATR-CQSZACIVSA-N |
| XLogP | 1.78 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |