C17H21N5OS — CID 99700858
(2S)-2-[4-[2-(2-ethylimidazol-1-yl)acetyl]piperazin-1-yl]-2-thiophen-2-ylacetonitrile (PubChem CID 99700858) has the molecular formula C17H21N5OS and a molecular weight of 343.46 g/mol. Its IUPAC name is (2S)-2-[4-[2-(2-ethylimidazol-1-yl)acetyl]piperazin-1-yl]-2-thiophen-2-ylacetonitrile.
| Compound Name | (2S)-2-[4-[2-(2-ethylimidazol-1-yl)acetyl]piperazin-1-yl]-2-thiophen-2-ylacetonitrile |
|---|---|
| PubChem CID | 99700858 |
| Molecular Formula | C17H21N5OS |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | (2S)-2-[4-[2-(2-ethylimidazol-1-yl)acetyl]piperazin-1-yl]-2-thiophen-2-ylacetonitrile |
| SMILES | CCc1nccn1CC(=O)N1CCN([C@@H](C#N)c2cccs2)CC1 |
| InChI | InChI=1S/C17H21N5OS/c1-2-16-19-5-6-22(16)13-17(23)21-9-7-20(8-10-21)14(12-18)15-4-3-11-24-15/h3-6,11,14H,2,7-10,13H2,1H3/t14-/m0/s1 |
| InChIKey | HOEJRQWTPACSSH-AWEZNQCLSA-N |
| XLogP | 1.92 |
| TPSA | 65.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |