C23H18BrClN2O2 — CID 997018
4-[(2-bromophenoxy)methyl]-N-[(5-chloro-1H-indol-2-yl)methyl]benzamide (PubChem CID 997018) has the molecular formula C23H18BrClN2O2 and a molecular weight of 469.77 g/mol. Its IUPAC name is 4-[(2-bromophenoxy)methyl]-N-[(5-chloro-1H-indol-2-yl)methyl]benzamide.
| Compound Name | 4-[(2-bromophenoxy)methyl]-N-[(5-chloro-1H-indol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 997018 |
| Molecular Formula | C23H18BrClN2O2 |
| Molecular Weight | 469.77 g/mol |
| Exact Mass | 468.02 |
| IUPAC Name | 4-[(2-bromophenoxy)methyl]-N-[(5-chloro-1H-indol-2-yl)methyl]benzamide |
| SMILES | O=C(NCc1cc2cc(Cl)ccc2[nH]1)c1ccc(COc2ccccc2Br)cc1 |
| InChI | InChI=1S/C23H18BrClN2O2/c24-20-3-1-2-4-22(20)29-14-15-5-7-16(8-6-15)23(28)26-13-19-12-17-11-18(25)9-10-21(17)27-19/h1-12,27H,13-14H2,(H,26,28) |
| InChIKey | IXMFNYWYQHOGHH-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.77 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |