C24H20Cl2N2O3 — CID 997399
N-[(5-chloro-1H-indol-2-yl)methyl]-3-[(2-chlorophenoxy)methyl]-4-methoxybenzamide (PubChem CID 997399) has the molecular formula C24H20Cl2N2O3 and a molecular weight of 455.34 g/mol. Its IUPAC name is N-[(5-chloro-1H-indol-2-yl)methyl]-3-[(2-chlorophenoxy)methyl]-4-methoxybenzamide.
| Compound Name | N-[(5-chloro-1H-indol-2-yl)methyl]-3-[(2-chlorophenoxy)methyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 997399 |
| Molecular Formula | C24H20Cl2N2O3 |
| Molecular Weight | 455.34 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | N-[(5-chloro-1H-indol-2-yl)methyl]-3-[(2-chlorophenoxy)methyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCc2cc3cc(Cl)ccc3[nH]2)cc1COc1ccccc1Cl |
| InChI | InChI=1S/C24H20Cl2N2O3/c1-30-22-9-6-15(10-17(22)14-31-23-5-3-2-4-20(23)26)24(29)27-13-19-12-16-11-18(25)7-8-21(16)28-19/h2-12,28H,13-14H2,1H3,(H,27,29) |
| InChIKey | JXLKQOBLLGMEGM-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.34 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |