C19H25N3O2 — CID 99702183
N-[(1R)-1-(3-pyrazol-1-ylphenyl)ethyl]-1,4-dioxaspiro[4.5]decan-8-amine (PubChem CID 99702183) has the molecular formula C19H25N3O2 and a molecular weight of 327.43 g/mol. Its IUPAC name is N-[(1R)-1-(3-pyrazol-1-ylphenyl)ethyl]-1,4-dioxaspiro[4.5]decan-8-amine.
| Compound Name | N-[(1R)-1-(3-pyrazol-1-ylphenyl)ethyl]-1,4-dioxaspiro[4.5]decan-8-amine |
|---|---|
| PubChem CID | 99702183 |
| Molecular Formula | C19H25N3O2 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | N-[(1R)-1-(3-pyrazol-1-ylphenyl)ethyl]-1,4-dioxaspiro[4.5]decan-8-amine |
| SMILES | C[C@@H](NC1CCC2(CC1)OCCO2)c1cccc(-n2cccn2)c1 |
| InChI | InChI=1S/C19H25N3O2/c1-15(16-4-2-5-18(14-16)22-11-3-10-20-22)21-17-6-8-19(9-7-17)23-12-13-24-19/h2-5,10-11,14-15,17,21H,6-9,12-13H2,1H3/t15-/m1/s1 |
| InChIKey | WQWDWBQIXWKHTB-OAHLLOKOSA-N |
| XLogP | 3.21 |
| TPSA | 48.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |