C15H29NO3 — CID 99704485
(3R)-N-[(2R)-2-cyclohexyl-1-hydroxypropan-2-yl]-3-hydroxy-4-methylpentanamide (PubChem CID 99704485) has the molecular formula C15H29NO3 and a molecular weight of 271.40 g/mol. Its IUPAC name is (3R)-N-[(2R)-2-cyclohexyl-1-hydroxypropan-2-yl]-3-hydroxy-4-methylpentanamide.
| Compound Name | (3R)-N-[(2R)-2-cyclohexyl-1-hydroxypropan-2-yl]-3-hydroxy-4-methylpentanamide |
|---|---|
| PubChem CID | 99704485 |
| Molecular Formula | C15H29NO3 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | (3R)-N-[(2R)-2-cyclohexyl-1-hydroxypropan-2-yl]-3-hydroxy-4-methylpentanamide |
| SMILES | CC(C)[C@H](O)CC(=O)N[C@@](C)(CO)C1CCCCC1 |
| InChI | InChI=1S/C15H29NO3/c1-11(2)13(18)9-14(19)16-15(3,10-17)12-7-5-4-6-8-12/h11-13,17-18H,4-10H2,1-3H3,(H,16,19)/t13-,15+/m1/s1 |
| InChIKey | AWMNZWMHDZRGLO-HIFRSBDPSA-N |
| XLogP | 1.84 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |