C16H32N2O3S — CID 97054897
1-[2-[(S)-tert-butylsulfinyl]ethyl]-3-[(2S)-2-cyclohexyl-1-hydroxypropan-2-yl]urea (PubChem CID 97054897) has the molecular formula C16H32N2O3S and a molecular weight of 332.51 g/mol. Its IUPAC name is 1-[2-[(S)-tert-butylsulfinyl]ethyl]-3-[(2S)-2-cyclohexyl-1-hydroxypropan-2-yl]urea.
| Compound Name | 1-[2-[(S)-tert-butylsulfinyl]ethyl]-3-[(2S)-2-cyclohexyl-1-hydroxypropan-2-yl]urea |
|---|---|
| PubChem CID | 97054897 |
| Molecular Formula | C16H32N2O3S |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | 1-[2-[(S)-tert-butylsulfinyl]ethyl]-3-[(2S)-2-cyclohexyl-1-hydroxypropan-2-yl]urea |
| SMILES | CC(C)(C)[S@@](=O)CCNC(=O)N[C@](C)(CO)C1CCCCC1 |
| InChI | InChI=1S/C16H32N2O3S/c1-15(2,3)22(21)11-10-17-14(20)18-16(4,12-19)13-8-6-5-7-9-13/h13,19H,5-12H2,1-4H3,(H2,17,18,20)/t16-,22+/m1/s1 |
| InChIKey | AZJWWTJCGRELHA-ZHRRBRCNSA-N |
| XLogP | 2.16 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |