C12H24N2O2S — CID 97321320
1-[(2S)-2-cyclopropyl-1-hydroxypropan-2-yl]-3-[(3R)-3-methylsulfanylbutyl]urea (PubChem CID 97321320) has the molecular formula C12H24N2O2S and a molecular weight of 260.40 g/mol. Its IUPAC name is 1-[(2S)-2-cyclopropyl-1-hydroxypropan-2-yl]-3-[(3R)-3-methylsulfanylbutyl]urea.
| Compound Name | 1-[(2S)-2-cyclopropyl-1-hydroxypropan-2-yl]-3-[(3R)-3-methylsulfanylbutyl]urea |
|---|---|
| PubChem CID | 97321320 |
| Molecular Formula | C12H24N2O2S |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.16 |
| IUPAC Name | 1-[(2S)-2-cyclopropyl-1-hydroxypropan-2-yl]-3-[(3R)-3-methylsulfanylbutyl]urea |
| SMILES | CS[C@H](C)CCNC(=O)N[C@](C)(CO)C1CC1 |
| InChI | InChI=1S/C12H24N2O2S/c1-9(17-3)6-7-13-11(16)14-12(2,8-15)10-4-5-10/h9-10,15H,4-8H2,1-3H3,(H2,13,14,16)/t9-,12-/m1/s1 |
| InChIKey | GSCDROBXGJVRPJ-BXKDBHETSA-N |
| XLogP | 1.59 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |