C12H23NO3S — CID 116537516
3,3-dimethyl-2-(3-methylsulfanylbutylcarbamoyl)butanoic acid (PubChem CID 116537516) has the molecular formula C12H23NO3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 3,3-dimethyl-2-(3-methylsulfanylbutylcarbamoyl)butanoic acid.
| Compound Name | 3,3-dimethyl-2-(3-methylsulfanylbutylcarbamoyl)butanoic acid |
|---|---|
| PubChem CID | 116537516 |
| Molecular Formula | C12H23NO3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 3,3-dimethyl-2-(3-methylsulfanylbutylcarbamoyl)butanoic acid |
| SMILES | CSC(C)CCNC(=O)C(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C12H23NO3S/c1-8(17-5)6-7-13-10(14)9(11(15)16)12(2,3)4/h8-9H,6-7H2,1-5H3,(H,13,14)(H,15,16) |
| InChIKey | WBOXDYQMASEDML-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|