C13H24N2O4 — CID 116537453
3,3-dimethyl-2-[[3-oxo-3-(propan-2-ylamino)propyl]carbamoyl]butanoic acid (PubChem CID 116537453) has the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. Its IUPAC name is 3,3-dimethyl-2-[[3-oxo-3-(propan-2-ylamino)propyl]carbamoyl]butanoic acid.
| Compound Name | 3,3-dimethyl-2-[[3-oxo-3-(propan-2-ylamino)propyl]carbamoyl]butanoic acid |
|---|---|
| PubChem CID | 116537453 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | 3,3-dimethyl-2-[[3-oxo-3-(propan-2-ylamino)propyl]carbamoyl]butanoic acid |
| SMILES | CC(C)NC(=O)CCNC(=O)C(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C13H24N2O4/c1-8(2)15-9(16)6-7-14-11(17)10(12(18)19)13(3,4)5/h8,10H,6-7H2,1-5H3,(H,14,17)(H,15,16)(H,18,19) |
| InChIKey | SKXAVHRRZBWABS-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|