C14H28N2O2S — CID 134403497
N'-tert-butyl-N-(3-methylsulfanylbutyl)pentanediamide (PubChem CID 134403497) has the molecular formula C14H28N2O2S and a molecular weight of 288.46 g/mol. Its IUPAC name is N'-tert-butyl-N-(3-methylsulfanylbutyl)pentanediamide.
| Compound Name | N'-tert-butyl-N-(3-methylsulfanylbutyl)pentanediamide |
|---|---|
| PubChem CID | 134403497 |
| Molecular Formula | C14H28N2O2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | N'-tert-butyl-N-(3-methylsulfanylbutyl)pentanediamide |
| SMILES | CSC(C)CCNC(=O)CCCC(=O)NC(C)(C)C |
| InChI | InChI=1S/C14H28N2O2S/c1-11(19-5)9-10-15-12(17)7-6-8-13(18)16-14(2,3)4/h11H,6-10H2,1-5H3,(H,15,17)(H,16,18) |
| InChIKey | XGVLHQOFACYQBP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |