C15H17N5OS — CID 99713940
1-[2-[(2S)-1-cyanopropan-2-yl]sulfanylphenyl]-3-(1-methylpyrazol-3-yl)urea (PubChem CID 99713940) has the molecular formula C15H17N5OS and a molecular weight of 315.40 g/mol. Its IUPAC name is 1-[2-[(2S)-1-cyanopropan-2-yl]sulfanylphenyl]-3-(1-methylpyrazol-3-yl)urea.
| Compound Name | 1-[2-[(2S)-1-cyanopropan-2-yl]sulfanylphenyl]-3-(1-methylpyrazol-3-yl)urea |
|---|---|
| PubChem CID | 99713940 |
| Molecular Formula | C15H17N5OS |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 1-[2-[(2S)-1-cyanopropan-2-yl]sulfanylphenyl]-3-(1-methylpyrazol-3-yl)urea |
| SMILES | C[C@@H](CC#N)Sc1ccccc1NC(=O)Nc1ccn(C)n1 |
| InChI | InChI=1S/C15H17N5OS/c1-11(7-9-16)22-13-6-4-3-5-12(13)17-15(21)18-14-8-10-20(2)19-14/h3-6,8,10-11H,7H2,1-2H3,(H2,17,18,19,21)/t11-/m0/s1 |
| InChIKey | AAAVOJPQYPRRMX-NSHDSACASA-N |
| XLogP | 3.46 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |