C17H21N5OS — CID 125130723
1-[2-[(2R)-1-cyanopropan-2-yl]sulfanylphenyl]-3-[(1S)-1-(1-methylpyrazol-4-yl)ethyl]urea (PubChem CID 125130723) has the molecular formula C17H21N5OS and a molecular weight of 343.46 g/mol. Its IUPAC name is 1-[2-[(2R)-1-cyanopropan-2-yl]sulfanylphenyl]-3-[(1S)-1-(1-methylpyrazol-4-yl)ethyl]urea.
| Compound Name | 1-[2-[(2R)-1-cyanopropan-2-yl]sulfanylphenyl]-3-[(1S)-1-(1-methylpyrazol-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 125130723 |
| Molecular Formula | C17H21N5OS |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 1-[2-[(2R)-1-cyanopropan-2-yl]sulfanylphenyl]-3-[(1S)-1-(1-methylpyrazol-4-yl)ethyl]urea |
| SMILES | C[C@H](CC#N)Sc1ccccc1NC(=O)N[C@@H](C)c1cnn(C)c1 |
| InChI | InChI=1S/C17H21N5OS/c1-12(8-9-18)24-16-7-5-4-6-15(16)21-17(23)20-13(2)14-10-19-22(3)11-14/h4-7,10-13H,8H2,1-3H3,(H2,20,21,23)/t12-,13+/m1/s1 |
| InChIKey | OTFXEUSTEDYQTD-OLZOCXBDSA-N |
| XLogP | 3.70 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |