C13H14Cl2N4O — CID 45147163
1-(2,3-dichlorophenyl)-3-[1-(1-methylpyrazol-4-yl)ethyl]urea (PubChem CID 45147163) has the molecular formula C13H14Cl2N4O and a molecular weight of 313.19 g/mol. Its IUPAC name is 1-(2,3-dichlorophenyl)-3-[1-(1-methylpyrazol-4-yl)ethyl]urea.
| Compound Name | 1-(2,3-dichlorophenyl)-3-[1-(1-methylpyrazol-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 45147163 |
| Molecular Formula | C13H14Cl2N4O |
| Molecular Weight | 313.19 g/mol |
| Exact Mass | 312.05 |
| IUPAC Name | 1-(2,3-dichlorophenyl)-3-[1-(1-methylpyrazol-4-yl)ethyl]urea |
| SMILES | CC(NC(=O)Nc1cccc(Cl)c1Cl)c1cnn(C)c1 |
| InChI | InChI=1S/C13H14Cl2N4O/c1-8(9-6-16-19(2)7-9)17-13(20)18-11-5-3-4-10(14)12(11)15/h3-8H,1-2H3,(H2,17,18,20) |
| InChIKey | VQBGXKQRSVSZDW-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.19 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |