C14H18ClN5O — CID 96524434
1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[(1R)-1-(1-methylpyrazol-4-yl)ethyl]urea (PubChem CID 96524434) has the molecular formula C14H18ClN5O and a molecular weight of 307.79 g/mol. Its IUPAC name is 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[(1R)-1-(1-methylpyrazol-4-yl)ethyl]urea.
| Compound Name | 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[(1R)-1-(1-methylpyrazol-4-yl)ethyl]urea |
|---|---|
| PubChem CID | 96524434 |
| Molecular Formula | C14H18ClN5O |
| Molecular Weight | 307.79 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 1-(2-chloro-4,6-dimethyl-3-pyridinyl)-3-[(1R)-1-(1-methylpyrazol-4-yl)ethyl]urea |
| SMILES | Cc1cc(C)c(NC(=O)N[C@H](C)c2cnn(C)c2)c(Cl)n1 |
| InChI | InChI=1S/C14H18ClN5O/c1-8-5-9(2)17-13(15)12(8)19-14(21)18-10(3)11-6-16-20(4)7-11/h5-7,10H,1-4H3,(H2,18,19,21)/t10-/m1/s1 |
| InChIKey | GMTPCWZIIVNVLP-SNVBAGLBSA-N |
| XLogP | 2.97 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.79 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|