About N-cyclopropyl-2-[(2S,4S)-4-hydroxy-2-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]acetamide
N-cyclopropyl-2-[(2S,4S)-4-hydroxy-2-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]acetamide (PubChem CID 99715090) has the molecular formula C16H19F3N2O2
and a molecular weight of 328.33 g/mol. Its IUPAC name is N-cyclopropyl-2-[(2S,4S)-4-hydroxy-2-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]acetamide.
Molecular Properties
| Compound Name | N-cyclopropyl-2-[(2S,4S)-4-hydroxy-2-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]acetamide |
| PubChem CID | 99715090 |
| Molecular Formula | C16H19F3N2O2 |
| Molecular Weight | 328.33 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | N-cyclopropyl-2-[(2S,4S)-4-hydroxy-2-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]acetamide |
| SMILES | O=C(CN1C[C@@H](O)C[C@H]1c1cccc(C(F)(F)F)c1)NC1CC1 |
| InChI | InChI=1S/C16H19F3N2O2/c17-16(18,19)11-3-1-2-10(6-11)14-7-13(22)8-21(14)9-15(23)20-12-4-5-12/h1-3,6,12-14,22H,4-5,7-9H2,(H,20,23)/t13-,14-/m0/s1 |
| InChIKey | STBYBLWWFQMKRU-KBPBESRZSA-N |
| XLogP | 2.09 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.33 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-cyclopropyl-2-[(2S,4S)-4-hydroxy-2-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-2-[(2S,4S)-4-hydroxy-2-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]acetamide?
The IUPAC name of N-cyclopropyl-2-[(2S,4S)-4-hydroxy-2-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]acetamide (CID 99715090) is N-cyclopropyl-2-[(2S,4S)-4-hydroxy-2-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]acetamide.
What is the SMILES notation for N-cyclopropyl-2-[(2S,4S)-4-hydroxy-2-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]acetamide?
The canonical SMILES for N-cyclopropyl-2-[(2S,4S)-4-hydroxy-2-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]acetamide is O=C(CN1C[C@@H](O)C[C@H]1c1cccc(C(F)(F)F)c1)NC1CC1.
What is the InChIKey of N-cyclopropyl-2-[(2S,4S)-4-hydroxy-2-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]acetamide?
The InChIKey is STBYBLWWFQMKRU-KBPBESRZSA-N. The full InChI is InChI=1S/C16H19F3N2O2/c17-16(18,19)11-3-1-2-10(6-11)14-7-13(22)8-21(14)9-15(23)20-12-4-5-12/h1-3,6,12-14,22H,4-5,7-9H2,(H,20,23)/t13-,14-/m0/s1.
What are the key properties of N-cyclopropyl-2-[(2S,4S)-4-hydroxy-2-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]acetamide?
N-cyclopropyl-2-[(2S,4S)-4-hydroxy-2-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]acetamide has a molecular weight of 328.33 g/mol, XLogP of 2.09, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-2-[(2S,4S)-4-hydroxy-2-[3-(trifluoromethyl)phenyl]pyrrolidin-1-yl]acetamide is sourced from PubChem (CID 99715090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).