C11H11FIN3O — CID 99715614
1-[(2R)-1-cyanopropan-2-yl]-3-(4-fluoro-2-iodophenyl)urea (PubChem CID 99715614) has the molecular formula C11H11FIN3O and a molecular weight of 347.13 g/mol. Its IUPAC name is 1-[(2R)-1-cyanopropan-2-yl]-3-(4-fluoro-2-iodophenyl)urea.
| Compound Name | 1-[(2R)-1-cyanopropan-2-yl]-3-(4-fluoro-2-iodophenyl)urea |
|---|---|
| PubChem CID | 99715614 |
| Molecular Formula | C11H11FIN3O |
| Molecular Weight | 347.13 g/mol |
| Exact Mass | 346.99 |
| IUPAC Name | 1-[(2R)-1-cyanopropan-2-yl]-3-(4-fluoro-2-iodophenyl)urea |
| SMILES | C[C@H](CC#N)NC(=O)Nc1ccc(F)cc1I |
| InChI | InChI=1S/C11H11FIN3O/c1-7(4-5-14)15-11(17)16-10-3-2-8(12)6-9(10)13/h2-3,6-7H,4H2,1H3,(H2,15,16,17)/t7-/m1/s1 |
| InChIKey | OAPCAMXMFXDVRL-SSDOTTSWSA-N |
| XLogP | 2.85 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.13 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|