About 1-[(3R)-1-hydroxy-4,4-dimethylpentan-3-yl]-3-[[(2R)-thiolan-2-yl]methyl]urea
1-[(3R)-1-hydroxy-4,4-dimethylpentan-3-yl]-3-[[(2R)-thiolan-2-yl]methyl]urea (PubChem CID 99717523) has the molecular formula C13H26N2O2S
and a molecular weight of 274.43 g/mol. Its IUPAC name is 1-[(3R)-1-hydroxy-4,4-dimethylpentan-3-yl]-3-[[(2R)-thiolan-2-yl]methyl]urea.
Molecular Properties
| Compound Name | 1-[(3R)-1-hydroxy-4,4-dimethylpentan-3-yl]-3-[[(2R)-thiolan-2-yl]methyl]urea |
| PubChem CID | 99717523 |
| Molecular Formula | C13H26N2O2S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-[(3R)-1-hydroxy-4,4-dimethylpentan-3-yl]-3-[[(2R)-thiolan-2-yl]methyl]urea |
| SMILES | CC(C)(C)[C@@H](CCO)NC(=O)NC[C@H]1CCCS1 |
| InChI | InChI=1S/C13H26N2O2S/c1-13(2,3)11(6-7-16)15-12(17)14-9-10-5-4-8-18-10/h10-11,16H,4-9H2,1-3H3,(H2,14,15,17)/t10-,11-/m1/s1 |
| InChIKey | KLEMFAAMJCJTTD-GHMZBOCLSA-N |
| XLogP | 1.98 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(3R)-1-hydroxy-4,4-dimethylpentan-3-yl]-3-[[(2R)-thiolan-2-yl]methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3R)-1-hydroxy-4,4-dimethylpentan-3-yl]-3-[[(2R)-thiolan-2-yl]methyl]urea?
The IUPAC name of 1-[(3R)-1-hydroxy-4,4-dimethylpentan-3-yl]-3-[[(2R)-thiolan-2-yl]methyl]urea (CID 99717523) is 1-[(3R)-1-hydroxy-4,4-dimethylpentan-3-yl]-3-[[(2R)-thiolan-2-yl]methyl]urea.
What is the SMILES notation for 1-[(3R)-1-hydroxy-4,4-dimethylpentan-3-yl]-3-[[(2R)-thiolan-2-yl]methyl]urea?
The canonical SMILES for 1-[(3R)-1-hydroxy-4,4-dimethylpentan-3-yl]-3-[[(2R)-thiolan-2-yl]methyl]urea is CC(C)(C)[C@@H](CCO)NC(=O)NC[C@H]1CCCS1.
What is the InChIKey of 1-[(3R)-1-hydroxy-4,4-dimethylpentan-3-yl]-3-[[(2R)-thiolan-2-yl]methyl]urea?
The InChIKey is KLEMFAAMJCJTTD-GHMZBOCLSA-N. The full InChI is InChI=1S/C13H26N2O2S/c1-13(2,3)11(6-7-16)15-12(17)14-9-10-5-4-8-18-10/h10-11,16H,4-9H2,1-3H3,(H2,14,15,17)/t10-,11-/m1/s1.
What are the key properties of 1-[(3R)-1-hydroxy-4,4-dimethylpentan-3-yl]-3-[[(2R)-thiolan-2-yl]methyl]urea?
1-[(3R)-1-hydroxy-4,4-dimethylpentan-3-yl]-3-[[(2R)-thiolan-2-yl]methyl]urea has a molecular weight of 274.43 g/mol, XLogP of 1.98, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3R)-1-hydroxy-4,4-dimethylpentan-3-yl]-3-[[(2R)-thiolan-2-yl]methyl]urea is sourced from PubChem (CID 99717523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).