C17H20N2O4S2 — CID 99718727
2-[(2R)-oxolan-2-yl]-N-[(2R)-2-phenylpropyl]sulfonyl-1,3-thiazole-4-carboxamide (PubChem CID 99718727) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is 2-[(2R)-oxolan-2-yl]-N-[(2R)-2-phenylpropyl]sulfonyl-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[(2R)-oxolan-2-yl]-N-[(2R)-2-phenylpropyl]sulfonyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 99718727 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 2-[(2R)-oxolan-2-yl]-N-[(2R)-2-phenylpropyl]sulfonyl-1,3-thiazole-4-carboxamide |
| SMILES | C[C@@H](CS(=O)(=O)NC(=O)c1csc([C@H]2CCCO2)n1)c1ccccc1 |
| InChI | InChI=1S/C17H20N2O4S2/c1-12(13-6-3-2-4-7-13)11-25(21,22)19-16(20)14-10-24-17(18-14)15-8-5-9-23-15/h2-4,6-7,10,12,15H,5,8-9,11H2,1H3,(H,19,20)/t12-,15+/m0/s1 |
| InChIKey | GVDJSUAJJODQQL-SWLSCSKDSA-N |
| XLogP | 2.86 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |