C17H21N3O4 — CID 99718901
5-[[(3S)-8-methyl-1,4-dioxaspiro[4.5]decan-3-yl]methylamino]-2-nitrobenzonitrile (PubChem CID 99718901) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is 5-[[(3S)-8-methyl-1,4-dioxaspiro[4.5]decan-3-yl]methylamino]-2-nitrobenzonitrile.
| Compound Name | 5-[[(3S)-8-methyl-1,4-dioxaspiro[4.5]decan-3-yl]methylamino]-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 99718901 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 5-[[(3S)-8-methyl-1,4-dioxaspiro[4.5]decan-3-yl]methylamino]-2-nitrobenzonitrile |
| SMILES | CC1CCC2(CC1)OC[C@H](CNc1ccc([N+](=O)[O-])c(C#N)c1)O2 |
| InChI | InChI=1S/C17H21N3O4/c1-12-4-6-17(7-5-12)23-11-15(24-17)10-19-14-2-3-16(20(21)22)13(8-14)9-18/h2-3,8,12,15,19H,4-7,10-11H2,1H3/t12?,15-,17?/m0/s1 |
| InChIKey | RCWBAYGWXDPJNO-VXKCQOAXSA-N |
| XLogP | 3.20 |
| TPSA | 97.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|