C11H14N6 — CID 99727825
2-[5-[(2R)-piperidin-2-yl]-1H-1,2,4-triazol-3-yl]pyrazine (PubChem CID 99727825) has the molecular formula C11H14N6 and a molecular weight of 230.27 g/mol. Its IUPAC name is 2-[5-[(2R)-piperidin-2-yl]-1H-1,2,4-triazol-3-yl]pyrazine.
| Compound Name | 2-[5-[(2R)-piperidin-2-yl]-1H-1,2,4-triazol-3-yl]pyrazine |
|---|---|
| PubChem CID | 99727825 |
| Molecular Formula | C11H14N6 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 2-[5-[(2R)-piperidin-2-yl]-1H-1,2,4-triazol-3-yl]pyrazine |
| SMILES | c1cnc(-c2n[nH]c([C@H]3CCCCN3)n2)cn1 |
| InChI | InChI=1S/C11H14N6/c1-2-4-13-8(3-1)10-15-11(17-16-10)9-7-12-5-6-14-9/h5-8,13H,1-4H2,(H,15,16,17)/t8-/m1/s1 |
| InChIKey | QHPAEAFYXCGMRJ-MRVPVSSYSA-N |
| XLogP | 1.08 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |