C14H23N3O3 — CID 99727967
3-[2-(oxan-4-ylmethoxy)ethyl]-5-[(2R)-pyrrolidin-2-yl]-1,2,4-oxadiazole (PubChem CID 99727967) has the molecular formula C14H23N3O3 and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-[2-(oxan-4-ylmethoxy)ethyl]-5-[(2R)-pyrrolidin-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-[2-(oxan-4-ylmethoxy)ethyl]-5-[(2R)-pyrrolidin-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 99727967 |
| Molecular Formula | C14H23N3O3 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.17 |
| IUPAC Name | 3-[2-(oxan-4-ylmethoxy)ethyl]-5-[(2R)-pyrrolidin-2-yl]-1,2,4-oxadiazole |
| SMILES | C1CN[C@@H](c2nc(CCOCC3CCOCC3)no2)C1 |
| InChI | InChI=1S/C14H23N3O3/c1-2-12(15-6-1)14-16-13(17-20-14)5-9-19-10-11-3-7-18-8-4-11/h11-12,15H,1-10H2/t12-/m1/s1 |
| InChIKey | KCRPCZMZDSWWTA-GFCCVEGCSA-N |
| XLogP | 1.48 |
| TPSA | 69.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|