C15H13N3O4 — CID 99734891
(1R,2S,7R,8R)-4-(4-nitrophenyl)-4,5-diazatricyclo[6.2.1.02,7]undec-9-ene-3,6-dione (PubChem CID 99734891) has the molecular formula C15H13N3O4 and a molecular weight of 299.29 g/mol. Its IUPAC name is (1R,2S,7R,8R)-4-(4-nitrophenyl)-4,5-diazatricyclo[6.2.1.02,7]undec-9-ene-3,6-dione.
| Compound Name | (1R,2S,7R,8R)-4-(4-nitrophenyl)-4,5-diazatricyclo[6.2.1.02,7]undec-9-ene-3,6-dione |
|---|---|
| PubChem CID | 99734891 |
| Molecular Formula | C15H13N3O4 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.09 |
| IUPAC Name | (1R,2S,7R,8R)-4-(4-nitrophenyl)-4,5-diazatricyclo[6.2.1.02,7]undec-9-ene-3,6-dione |
| SMILES | O=C1NN(c2ccc([N+](=O)[O-])cc2)C(=O)[C@@H]2[C@H]1[C@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C15H13N3O4/c19-14-12-8-1-2-9(7-8)13(12)15(20)17(16-14)10-3-5-11(6-4-10)18(21)22/h1-6,8-9,12-13H,7H2,(H,16,19)/t8-,9-,12+,13-/m0/s1 |
| InChIKey | KSKYUERSKUVUJX-NGERZBJRSA-N |
| XLogP | 1.41 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|