C29H38N4O3S2 — CID 99736478
2-[(2S)-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-1-oxobutan-2-yl]sulfanyl-N,N,5-trimethyl-4-oxo-3-(2-phenylethyl)thieno[2,3-d]pyrimidine-6-carboxamide (PubChem CID 99736478) has the molecular formula C29H38N4O3S2 and a molecular weight of 554.78 g/mol. Its IUPAC name is 2-[(2S)-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-1-oxobutan-2-yl]sulfanyl-N,N,5-trimethyl-4-oxo-3-(2-phenylethyl)thieno[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 2-[(2S)-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-1-oxobutan-2-yl]sulfanyl-N,N,5-trimethyl-4-oxo-3-(2-phenylethyl)thieno[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 99736478 |
| Molecular Formula | C29H38N4O3S2 |
| Molecular Weight | 554.78 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | 2-[(2S)-1-[(3R,5R)-3,5-dimethylpiperidin-1-yl]-1-oxobutan-2-yl]sulfanyl-N,N,5-trimethyl-4-oxo-3-(2-phenylethyl)thieno[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CC[C@H](Sc1nc2sc(C(=O)N(C)C)c(C)c2c(=O)n1CCc1ccccc1)C(=O)N1C[C@H](C)C[C@@H](C)C1 |
| InChI | InChI=1S/C29H38N4O3S2/c1-7-22(26(34)32-16-18(2)15-19(3)17-32)37-29-30-25-23(20(4)24(38-25)28(36)31(5)6)27(35)33(29)14-13-21-11-9-8-10-12-21/h8-12,18-19,22H,7,13-17H2,1-6H3/t18-,19-,22+/m1/s1 |
| InChIKey | NJZBBXHGTIDSGP-KNKQGSTJSA-N |
| XLogP | 5.09 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.78 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |