C11H14ClNO2S — CID 99737731
methyl (2R,3R)-2-amino-3-(4-chlorophenyl)sulfanylbutanoate (PubChem CID 99737731) has the molecular formula C11H14ClNO2S and a molecular weight of 259.76 g/mol. Its IUPAC name is methyl (2R,3R)-2-amino-3-(4-chlorophenyl)sulfanylbutanoate.
| Compound Name | methyl (2R,3R)-2-amino-3-(4-chlorophenyl)sulfanylbutanoate |
|---|---|
| PubChem CID | 99737731 |
| Molecular Formula | C11H14ClNO2S |
| Molecular Weight | 259.76 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | methyl (2R,3R)-2-amino-3-(4-chlorophenyl)sulfanylbutanoate |
| SMILES | COC(=O)[C@@H](N)[C@@H](C)Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H14ClNO2S/c1-7(10(13)11(14)15-2)16-9-5-3-8(12)4-6-9/h3-7,10H,13H2,1-2H3/t7-,10+/m1/s1 |
| InChIKey | VLQBMHHVFGIEPR-XCBNKYQSSA-N |
| XLogP | 2.32 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.76 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |