C9H12N2O4S — CID 99737820
methyl (2S,4S)-4-(2,4-dioxo-1,3-thiazolidin-3-yl)pyrrolidine-2-carboxylate (PubChem CID 99737820) has the molecular formula C9H12N2O4S and a molecular weight of 244.27 g/mol. Its IUPAC name is methyl (2S,4S)-4-(2,4-dioxo-1,3-thiazolidin-3-yl)pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S,4S)-4-(2,4-dioxo-1,3-thiazolidin-3-yl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 99737820 |
| Molecular Formula | C9H12N2O4S |
| Molecular Weight | 244.27 g/mol |
| Exact Mass | 244.05 |
| IUPAC Name | methyl (2S,4S)-4-(2,4-dioxo-1,3-thiazolidin-3-yl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@H](N2C(=O)CSC2=O)CN1 |
| InChI | InChI=1S/C9H12N2O4S/c1-15-8(13)6-2-5(3-10-6)11-7(12)4-16-9(11)14/h5-6,10H,2-4H2,1H3/t5-,6-/m0/s1 |
| InChIKey | JZIPEFDFHGDIPK-WDSKDSINSA-N |
| XLogP | -0.41 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.27 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|