C24H25N5O2 — CID 99741441
N-[(3R)-1-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-1H-indole-4-carboxamide (PubChem CID 99741441) has the molecular formula C24H25N5O2 and a molecular weight of 415.50 g/mol. Its IUPAC name is N-[(3R)-1-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-1H-indole-4-carboxamide.
| Compound Name | N-[(3R)-1-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-1H-indole-4-carboxamide |
|---|---|
| PubChem CID | 99741441 |
| Molecular Formula | C24H25N5O2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | N-[(3R)-1-[5-(4-methoxyphenyl)-1H-pyrazol-3-yl]piperidin-3-yl]-1H-indole-4-carboxamide |
| SMILES | COc1ccc(-c2cc(N3CCC[C@@H](NC(=O)c4cccc5[nH]ccc45)C3)n[nH]2)cc1 |
| InChI | InChI=1S/C24H25N5O2/c1-31-18-9-7-16(8-10-18)22-14-23(28-27-22)29-13-3-4-17(15-29)26-24(30)20-5-2-6-21-19(20)11-12-25-21/h2,5-12,14,17,25H,3-4,13,15H2,1H3,(H,26,30)(H,27,28)/t17-/m1/s1 |
| InChIKey | KLGFBXXOAKIXCH-QGZVFWFLSA-N |
| XLogP | 3.97 |
| TPSA | 86.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |