C9H6F5NO3 — CID 99770396
1-methoxy-3-nitro-2-(1,1,2,2,2-pentafluoroethyl)benzene (PubChem CID 99770396) has the molecular formula C9H6F5NO3 and a molecular weight of 271.14 g/mol. Its IUPAC name is 1-methoxy-3-nitro-2-(1,1,2,2,2-pentafluoroethyl)benzene.
| Compound Name | 1-methoxy-3-nitro-2-(1,1,2,2,2-pentafluoroethyl)benzene |
|---|---|
| PubChem CID | 99770396 |
| Molecular Formula | C9H6F5NO3 |
| Molecular Weight | 271.14 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 1-methoxy-3-nitro-2-(1,1,2,2,2-pentafluoroethyl)benzene |
| SMILES | COc1cccc([N+](=O)[O-])c1C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H6F5NO3/c1-18-6-4-2-3-5(15(16)17)7(6)8(10,11)9(12,13)14/h2-4H,1H3 |
| InChIKey | WQXGINUSGKVXEF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.14 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|