C14H38B2P2 — CID 99770819
[(boranuidyl-tert-butyl-methylphosphaniumyl)methyl-ditert-butylphosphaniumyl]boranuide (PubChem CID 99770819) has the molecular formula C14H38B2P2 and a molecular weight of 290.03 g/mol. Its IUPAC name is [(boranuidyl-tert-butyl-methylphosphaniumyl)methyl-ditert-butylphosphaniumyl]boranuide.
| Compound Name | [(boranuidyl-tert-butyl-methylphosphaniumyl)methyl-ditert-butylphosphaniumyl]boranuide |
|---|---|
| PubChem CID | 99770819 |
| Molecular Formula | C14H38B2P2 |
| Molecular Weight | 290.03 g/mol |
| Exact Mass | 290.26 |
| IUPAC Name | [(boranuidyl-tert-butyl-methylphosphaniumyl)methyl-ditert-butylphosphaniumyl]boranuide |
| SMILES | [BH3-][P+](C)(C[P+]([BH3-])(C(C)(C)C)C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C14H38B2P2/c1-12(2,3)17(10,15)11-18(16,13(4,5)6)14(7,8)9/h11H2,1-10,15-16H3 |
| InChIKey | BQBJOLWOKQKQAO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.03 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|