About ditert-butyl(dimethyl)phosphanium;tetrabutylboranuide
ditert-butyl(dimethyl)phosphanium;tetrabutylboranuide (PubChem CID 156801058) has the molecular formula C26H60BP
and a molecular weight of 414.55 g/mol. Its IUPAC name is ditert-butyl(dimethyl)phosphanium;tetrabutylboranuide.
Molecular Properties
| Compound Name | ditert-butyl(dimethyl)phosphanium;tetrabutylboranuide |
| PubChem CID | 156801058 |
| Molecular Formula | C26H60BP |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.45 |
| IUPAC Name | ditert-butyl(dimethyl)phosphanium;tetrabutylboranuide |
| SMILES | CC(C)(C)[P+](C)(C)C(C)(C)C.CCCC[B-](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C16H36B.C10H24P/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-9(2,3)11(7,8)10(4,5)6/h5-16H2,1-4H3;1-8H3/q-1;+1 |
| InChIKey | ZWAZDWVEACUPSN-UHFFFAOYSA-N |
| XLogP | 10.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl(dimethyl)phosphanium;tetrabutylboranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl(dimethyl)phosphanium;tetrabutylboranuide?
The IUPAC name of ditert-butyl(dimethyl)phosphanium;tetrabutylboranuide (CID 156801058) is ditert-butyl(dimethyl)phosphanium;tetrabutylboranuide.
What is the SMILES notation for ditert-butyl(dimethyl)phosphanium;tetrabutylboranuide?
The canonical SMILES for ditert-butyl(dimethyl)phosphanium;tetrabutylboranuide is CC(C)(C)[P+](C)(C)C(C)(C)C.CCCC[B-](CCCC)(CCCC)CCCC.
What is the InChIKey of ditert-butyl(dimethyl)phosphanium;tetrabutylboranuide?
The InChIKey is ZWAZDWVEACUPSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36B.C10H24P/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-9(2,3)11(7,8)10(4,5)6/h5-16H2,1-4H3;1-8H3/q-1;+1.
What are the key properties of ditert-butyl(dimethyl)phosphanium;tetrabutylboranuide?
ditert-butyl(dimethyl)phosphanium;tetrabutylboranuide has a molecular weight of 414.55 g/mol, XLogP of 10.50, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl(dimethyl)phosphanium;tetrabutylboranuide is sourced from PubChem (CID 156801058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).