C17H22BNO5 — CID 99774931
(3S)-5-oxo-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine-3-carboxylic acid (PubChem CID 99774931) has the molecular formula C17H22BNO5 and a molecular weight of 331.18 g/mol. Its IUPAC name is (3S)-5-oxo-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine-3-carboxylic acid.
| Compound Name | (3S)-5-oxo-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 99774931 |
| Molecular Formula | C17H22BNO5 |
| Molecular Weight | 331.18 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | (3S)-5-oxo-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyrrolidine-3-carboxylic acid |
| SMILES | CC1(C)OB(c2ccc(N3C[C@@H](C(=O)O)CC3=O)cc2)OC1(C)C |
| InChI | InChI=1S/C17H22BNO5/c1-16(2)17(3,4)24-18(23-16)12-5-7-13(8-6-12)19-10-11(15(21)22)9-14(19)20/h5-8,11H,9-10H2,1-4H3,(H,21,22)/t11-/m0/s1 |
| InChIKey | FEKIQEGUUDXGER-NSHDSACASA-N |
| XLogP | 1.42 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.18 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|