C16H17N5O3 — CID 99775116
1-[(1R)-1-(furan-2-yl)-2-methoxyethyl]-3-(1-pyridin-2-ylpyrazol-4-yl)urea (PubChem CID 99775116) has the molecular formula C16H17N5O3 and a molecular weight of 327.34 g/mol. Its IUPAC name is 1-[(1R)-1-(furan-2-yl)-2-methoxyethyl]-3-(1-pyridin-2-ylpyrazol-4-yl)urea.
| Compound Name | 1-[(1R)-1-(furan-2-yl)-2-methoxyethyl]-3-(1-pyridin-2-ylpyrazol-4-yl)urea |
|---|---|
| PubChem CID | 99775116 |
| Molecular Formula | C16H17N5O3 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1-[(1R)-1-(furan-2-yl)-2-methoxyethyl]-3-(1-pyridin-2-ylpyrazol-4-yl)urea |
| SMILES | COC[C@@H](NC(=O)Nc1cnn(-c2ccccn2)c1)c1ccco1 |
| InChI | InChI=1S/C16H17N5O3/c1-23-11-13(14-5-4-8-24-14)20-16(22)19-12-9-18-21(10-12)15-6-2-3-7-17-15/h2-10,13H,11H2,1H3,(H2,19,20,22)/t13-/m1/s1 |
| InChIKey | DGPXLEXCPQYCAC-CYBMUJFWSA-N |
| XLogP | 2.37 |
| TPSA | 94.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |