C15H15F3N2O4 — CID 97062764
1-[2-(difluoromethoxy)-5-fluorophenyl]-3-[(1R)-1-(furan-2-yl)-2-methoxyethyl]urea (PubChem CID 97062764) has the molecular formula C15H15F3N2O4 and a molecular weight of 344.29 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)-5-fluorophenyl]-3-[(1R)-1-(furan-2-yl)-2-methoxyethyl]urea.
| Compound Name | 1-[2-(difluoromethoxy)-5-fluorophenyl]-3-[(1R)-1-(furan-2-yl)-2-methoxyethyl]urea |
|---|---|
| PubChem CID | 97062764 |
| Molecular Formula | C15H15F3N2O4 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | 1-[2-(difluoromethoxy)-5-fluorophenyl]-3-[(1R)-1-(furan-2-yl)-2-methoxyethyl]urea |
| SMILES | COC[C@@H](NC(=O)Nc1cc(F)ccc1OC(F)F)c1ccco1 |
| InChI | InChI=1S/C15H15F3N2O4/c1-22-8-11(12-3-2-6-23-12)20-15(21)19-10-7-9(16)4-5-13(10)24-14(17)18/h2-7,11,14H,8H2,1H3,(H2,19,20,21)/t11-/m1/s1 |
| InChIKey | GKXHQJXELFWLNG-LLVKDONJSA-N |
| XLogP | 3.53 |
| TPSA | 72.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |