C19H23N3O3 — CID 99775600
(1S)-2-[(2R)-1-(5-nitro-2-pyridinyl)azepan-2-yl]-1-phenylethanol (PubChem CID 99775600) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is (1S)-2-[(2R)-1-(5-nitro-2-pyridinyl)azepan-2-yl]-1-phenylethanol.
| Compound Name | (1S)-2-[(2R)-1-(5-nitro-2-pyridinyl)azepan-2-yl]-1-phenylethanol |
|---|---|
| PubChem CID | 99775600 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | (1S)-2-[(2R)-1-(5-nitro-2-pyridinyl)azepan-2-yl]-1-phenylethanol |
| SMILES | O=[N+]([O-])c1ccc(N2CCCCC[C@@H]2C[C@H](O)c2ccccc2)nc1 |
| InChI | InChI=1S/C19H23N3O3/c23-18(15-7-3-1-4-8-15)13-16-9-5-2-6-12-21(16)19-11-10-17(14-20-19)22(24)25/h1,3-4,7-8,10-11,14,16,18,23H,2,5-6,9,12-13H2/t16-,18+/m1/s1 |
| InChIKey | NHRNDQYJRLZPOX-AEFFLSMTSA-N |
| XLogP | 3.86 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|