C17H16ClFN2O4 — CID 99779224
4-chloro-N-[(1S,2R)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-2-methyl-6-nitrobenzamide (PubChem CID 99779224) has the molecular formula C17H16ClFN2O4 and a molecular weight of 366.78 g/mol. Its IUPAC name is 4-chloro-N-[(1S,2R)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-2-methyl-6-nitrobenzamide.
| Compound Name | 4-chloro-N-[(1S,2R)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-2-methyl-6-nitrobenzamide |
|---|---|
| PubChem CID | 99779224 |
| Molecular Formula | C17H16ClFN2O4 |
| Molecular Weight | 366.78 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | 4-chloro-N-[(1S,2R)-1-(4-fluorophenyl)-1-hydroxypropan-2-yl]-2-methyl-6-nitrobenzamide |
| SMILES | Cc1cc(Cl)cc([N+](=O)[O-])c1C(=O)N[C@H](C)[C@@H](O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H16ClFN2O4/c1-9-7-12(18)8-14(21(24)25)15(9)17(23)20-10(2)16(22)11-3-5-13(19)6-4-11/h3-8,10,16,22H,1-2H3,(H,20,23)/t10-,16-/m1/s1 |
| InChIKey | PIYRZSLRAMEZAE-QLJPJBMISA-N |
| XLogP | 3.55 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.78 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|