C17H15ClFN3O2 — CID 111116794
1-(3-chloro-4-cyanophenyl)-3-[1-(4-fluorophenyl)-1-hydroxypropan-2-yl]urea (PubChem CID 111116794) has the molecular formula C17H15ClFN3O2 and a molecular weight of 347.78 g/mol. Its IUPAC name is 1-(3-chloro-4-cyanophenyl)-3-[1-(4-fluorophenyl)-1-hydroxypropan-2-yl]urea.
| Compound Name | 1-(3-chloro-4-cyanophenyl)-3-[1-(4-fluorophenyl)-1-hydroxypropan-2-yl]urea |
|---|---|
| PubChem CID | 111116794 |
| Molecular Formula | C17H15ClFN3O2 |
| Molecular Weight | 347.78 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | 1-(3-chloro-4-cyanophenyl)-3-[1-(4-fluorophenyl)-1-hydroxypropan-2-yl]urea |
| SMILES | CC(NC(=O)Nc1ccc(C#N)c(Cl)c1)C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15ClFN3O2/c1-10(16(23)11-2-5-13(19)6-3-11)21-17(24)22-14-7-4-12(9-20)15(18)8-14/h2-8,10,16,23H,1H3,(H2,21,22,24) |
| InChIKey | PMVVMZYXNDQYFE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.78 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |